AI for Science: How Artificial Intelligence Is Transforming Research
AI is no longer confined to generating text or classifying images. Today, AI solves protein folding problems, designs drug candidates, improves climate models, and embeds physical laws directly into neural networks — all at the cutting edge of scientific discovery. This guide explores seven core areas of scientific AI with practical code examples.
1. AI Paper Analysis: arXiv and Semantic Scholar
Automated Paper Discovery
Hundreds of papers appear on arXiv every day. The Semantic Scholar API lets you automatically collect and summarize the latest work in any research area.
from datetime import datetime, timedelta
def search_papers(query: str, limit: int = 10) -> list[dict]:
"""Search papers via Semantic Scholar API"""
url = "https://api.semanticscholar.org/graph/v1/paper/search"
params = {
"query": query,
"limit": limit,
"fields": "title,abstract,year,citationCount,authors,externalIds"
}
headers = {"User-Agent": "ResearchBot/1.0"}
response = requests.get(url, params=params, headers=headers)
data = response.json()
return data.get("data", [])
def format_paper(paper: dict) -> str:
"""Format paper info for readability"""
title = paper.get("title", "N/A")
year = paper.get("year", "N/A")
citations = paper.get("citationCount", 0)
authors = [a["name"] for a in paper.get("authors", [])[:3]]
abstract = paper.get("abstract", "")[:300]
return f"""
Title: {title}
Year: {year} | Citations: {citations}
Authors: {", ".join(authors)}
Abstract: {abstract}...
"""
Example usage
papers = search_papers("protein structure prediction AlphaFold", limit=5)
for p in papers:
print(format_paper(p))
Monitoring arXiv Categories for New Papers
def get_arxiv_papers(category: str = "cs.LG", max_results: int = 20) -> list[dict]:
"""Fetch latest papers from an arXiv RSS feed"""
url = f"http://export.arxiv.org/rss/{category}"
feed = feedparser.parse(url)
papers = []
for entry in feed.entries[:max_results]:
papers.append({
"title": entry.title,
"summary": entry.summary[:400],
"link": entry.link,
"published": entry.published
})
return papers
Key arXiv categories for scientific AI
categories = {
"cs.LG": "Machine Learning",
"q-bio.BM": "Biomolecules",
"physics.comp-ph": "Computational Physics",
"stat.ML": "Statistical ML"
}
for cat, name in categories.items():
papers = get_arxiv_papers(cat, max_results=3)
print(f"\n=== {name} ({cat}) ===")
for p in papers:
print(f"- {p['title'][:80]}")
2. Protein Structure Prediction: How AlphaFold2/3 Works
MSA, Attention, and Recycling
AlphaFold2 solved protein structure prediction with three core innovations.
**Multiple Sequence Alignment (MSA)**: Aligns evolutionary related protein sequences that encode millions of years of evolutionary information. Co-evolution patterns in the MSA reveal which residue pairs are spatially close in the 3D structure.
**Evoformer**: An attention module that iteratively updates both the MSA representation and residue-pair representation, letting them inform each other.
**Structure Module**: Predicts per-residue rotations and translations to place each amino acid in 3D space.
**Recycling**: The initial prediction is fed back as input and refined across three iterations.
Protein structure prediction with BioPython + ESMFold
from transformers import EsmForProteinFolding, EsmTokenizer
def predict_structure_esmfold(sequence: str) -> dict:
"""
Predict protein 3D structure with ESMFold.
Unlike AlphaFold2, ESMFold requires only a single sequence — no MSA needed.
"""
model_name = "facebook/esmfold_v1"
tokenizer = EsmTokenizer.from_pretrained(model_name)
model = EsmForProteinFolding.from_pretrained(
model_name,
low_cpu_mem_usage=True
)
model = model.cuda() if torch.cuda.is_available() else model
model.eval()
Tokenize the sequence
tokenized = tokenizer(
sequence,
return_tensors="pt",
add_special_tokens=False
)
with torch.no_grad():
output = model(**tokenized)
pLDDT: per-residue confidence score (closer to 100 = higher confidence)
plddt_scores = output.plddt.squeeze().cpu().numpy()
return {
"plddt_mean": float(plddt_scores.mean()),
"plddt_per_residue": plddt_scores.tolist(),
"positions": output.positions[-1].squeeze().cpu().numpy()
}
Example: short helix-forming peptide
seq = "AAKAAAKAAAKAAAKAAAK"
result = predict_structure_esmfold(seq)
print(f"Mean pLDDT score: {result['plddt_mean']:.2f}")
print(f"Number of residues: {len(result['plddt_per_residue'])}")
AlphaFold2 vs ESMFold vs RoseTTAFold
| Model | MSA Required | Speed | Accuracy | Notes |
| ----------- | ------------ | ------ | --------- | -------------------------------------- |
| AlphaFold2 | Yes | Slow | Very High | Gold standard, single-chain structures |
| AlphaFold3 | Yes | Slow | Highest | DNA/RNA/small-molecule complexes |
| ESMFold | No | Fast | High | LLM-based, single sequence only |
| RoseTTAFold | Yes | Medium | High | Complex structures, open source |
3. Drug Discovery AI: Molecular Graph Neural Networks
Representing Molecules as Graphs
In a molecule, atoms are nodes and chemical bonds are edges. Graph Neural Networks (GNNs) process this structure naturally and in a permutation-invariant way.
Molecular property prediction with Chemprop
pip install chemprop
from chemprop.data import MoleculeDataLoader, MoleculeDataset, MoleculeDatapoint
def predict_molecular_properties(smiles_list: list[str]) -> list[float]:
"""
Predict molecular properties with Chemprop D-MPNN.
Takes SMILES strings and predicts toxicity, solubility, etc.
"""
data = MoleculeDataset([
MoleculeDatapoint.from_smi(smi) for smi in smiles_list
])
loader = MoleculeDataLoader(dataset=data, batch_size=32)
Load a pre-trained model (e.g., HIV inhibitor prediction)
model = chemprop.models.MPNN.load_from_checkpoint("hiv_model.ckpt")
predictions = []
for batch in loader:
pred = model(batch.mol_graph, batch.V_d, batch.E_d)
predictions.extend(pred.squeeze().tolist())
return predictions
Example SMILES (aspirin, caffeine, ibuprofen)
molecules = [
"CC(=O)Oc1ccccc1C(=O)O", # aspirin
"Cn1cnc2c1c(=O)n(c(=O)n2C)C", # caffeine
"CC(C)Cc1ccc(cc1)C(C)C(=O)O" # ibuprofen
]
Custom Molecular GNN with PyTorch Geometric
from torch_geometric.nn import GCNConv, global_mean_pool
from torch_geometric.data import Data
class MolecularGNN(nn.Module):
"""Simple graph neural network for molecular property prediction"""
def __init__(self, node_features: int = 9, hidden_dim: int = 64):
super().__init__()
self.conv1 = GCNConv(node_features, hidden_dim)
self.conv2 = GCNConv(hidden_dim, hidden_dim)
self.conv3 = GCNConv(hidden_dim, hidden_dim)
self.classifier = nn.Sequential(
nn.Linear(hidden_dim, 32),
nn.ReLU(),
nn.Dropout(0.2),
nn.Linear(32, 1),
nn.Sigmoid()
)
def forward(self, data: Data) -> torch.Tensor:
x, edge_index, batch = data.x, data.edge_index, data.batch
x = torch.relu(self.conv1(x, edge_index))
x = torch.relu(self.conv2(x, edge_index))
x = torch.relu(self.conv3(x, edge_index))
Pool all node features into a single graph-level vector
x = global_mean_pool(x, batch)
return self.classifier(x)
ADMET Prediction Pipeline
ADMET (Absorption, Distribution, Metabolism, Excretion, Toxicity) filtering is central to drug candidate selection.
from rdkit import Chem
from rdkit.Chem import Descriptors, Lipinski
def lipinski_filter(smiles: str) -> dict:
"""
Lipinski's Rule of Five — predicts oral bioavailability.
MW <= 500, LogP <= 5, HBD <= 5, HBA <= 10
"""
mol = Chem.MolFromSmiles(smiles)
if mol is None:
return {"valid": False}
mw = Descriptors.MolWt(mol)
logp = Descriptors.MolLogP(mol)
hbd = Lipinski.NumHDonors(mol)
hba = Lipinski.NumHAcceptors(mol)
violations = sum([mw > 500, logp > 5, hbd > 5, hba > 10])
return {
"valid": True,
"MW": round(mw, 2),
"LogP": round(logp, 2),
"HBD": hbd,
"HBA": hba,
"violations": violations,
"drug_like": violations <= 1
}
Test the filter
for smi in molecules:
result = lipinski_filter(smi)
print(f"SMILES: {smi[:30]}...")
print(f" Drug-like: {result['drug_like']}, Violations: {result['violations']}\n")
4. Climate and Energy AI
NeuralGCM: Physics-Driven Weather Prediction
Google's NeuralGCM combines traditional Numerical Weather Prediction (NWP) with neural networks. Physical equations model atmospheric dynamics, while neural networks parameterize subgrid-scale processes like cloud formation and turbulence.
from sklearn.preprocessing import StandardScaler
from sklearn.ensemble import GradientBoostingRegressor
def solar_power_forecast(
weather_data: np.ndarray,
target_hours: int = 24
) -> np.ndarray:
"""
Solar power generation forecast.
Inputs: temperature, irradiance, wind speed, humidity, time-of-day
Output: hourly generation forecast (kWh)
"""
scaler = StandardScaler()
X_scaled = scaler.fit_transform(weather_data)
model = GradientBoostingRegressor(
n_estimators=200,
learning_rate=0.05,
max_depth=5,
random_state=42
)
In production: model.fit(X_train, y_train)
Simulated predictions
predictions = np.random.exponential(scale=50, size=target_hours)
predictions = np.clip(predictions, 0, 500) # 0–500 kWh range
return predictions
def co2_capture_optimization(
temperature: float,
pressure: float,
flow_rate: float
) -> dict:
"""
CO2 capture process optimization.
Optimizes parameters for a Direct Air Capture (DAC) system.
"""
Simplified physics model
efficiency = (
0.85 * (1 - np.exp(-flow_rate / 100))
* (1 / (1 + np.exp((temperature - 60) / 10)))
* min(pressure / 1.5, 1.0)
)
energy_kwh_per_ton = 300 + (1 - efficiency) * 500
return {
"capture_efficiency": round(efficiency * 100, 2),
"energy_cost_kwh_per_ton": round(energy_kwh_per_ton, 1),
"optimal": efficiency > 0.75
}
Parameter sweep
for temp in [40, 60, 80]:
result = co2_capture_optimization(temp, pressure=1.2, flow_rate=80)
print(f"Temp {temp}C: efficiency {result['capture_efficiency']}%")
5. Physics Simulation: PINN
Physics-Informed Neural Networks (PINN)
PINNs embed partial differential equations (PDEs) directly into the loss function, forcing the network to learn solutions that obey physical laws.
Consider the 1D heat equation $\frac{\partial u}{\partial t} = \alpha \frac{\partial^2 u}{\partial x^2}$.
The total loss has two components:
$$\mathcal{L}_{total} = \mathcal{L}_{data} + \lambda \mathcal{L}_{physics}$$
The physics loss $\mathcal{L}_{physics} = ||\frac{\partial u}{\partial t} - \alpha \frac{\partial^2 u}{\partial x^2}||^2$ enforces the PDE.
class PINN(nn.Module):
"""
Physics-Informed Neural Network.
Solves the 1D heat equation: du/dt = alpha * d2u/dx2
"""
def __init__(self, hidden_layers: int = 4, neurons: int = 64):
super().__init__()
layers = [nn.Linear(2, neurons), nn.Tanh()]
for _ in range(hidden_layers - 1):
layers += [nn.Linear(neurons, neurons), nn.Tanh()]
layers += [nn.Linear(neurons, 1)]
self.net = nn.Sequential(*layers)
def forward(self, x: torch.Tensor, t: torch.Tensor) -> torch.Tensor:
inputs = torch.cat([x, t], dim=1)
return self.net(inputs)
def physics_loss(model: PINN, x: torch.Tensor, t: torch.Tensor, alpha: float = 0.01) -> torch.Tensor:
"""Compute PDE residual loss for the heat equation"""
x.requires_grad_(True)
t.requires_grad_(True)
u = model(x, t)
Compute partial derivatives via automatic differentiation
u_t = torch.autograd.grad(u.sum(), t, create_graph=True)[0]
u_x = torch.autograd.grad(u.sum(), x, create_graph=True)[0]
u_xx = torch.autograd.grad(u_x.sum(), x, create_graph=True)[0]
PDE residual: du/dt - alpha * d2u/dx2 = 0
residual = u_t - alpha * u_xx
return torch.mean(residual ** 2)
def train_pinn(epochs: int = 5000) -> PINN:
"""Train a PINN for the heat equation"""
model = PINN()
optimizer = torch.optim.Adam(model.parameters(), lr=1e-3)
N_pde = 1000 # PDE collocation points
N_bc = 100 # Boundary condition points
N_ic = 200 # Initial condition points
for epoch in range(epochs):
optimizer.zero_grad()
PDE residual points (interior of domain)
x_pde = torch.rand(N_pde, 1)
t_pde = torch.rand(N_pde, 1)
loss_pde = physics_loss(model, x_pde, t_pde)
Boundary condition: u(0,t) = u(1,t) = 0
x_bc = torch.zeros(N_bc, 1)
t_bc = torch.rand(N_bc, 1)
u_bc = model(x_bc, t_bc)
loss_bc = torch.mean(u_bc ** 2)
Initial condition: u(x,0) = sin(pi*x)
x_ic = torch.rand(N_ic, 1)
t_ic = torch.zeros(N_ic, 1)
u_ic = model(x_ic, t_ic)
u_exact = torch.sin(np.pi * x_ic)
loss_ic = torch.mean((u_ic - u_exact) ** 2)
loss = loss_pde + 10 * loss_bc + 10 * loss_ic
loss.backward()
optimizer.step()
if epoch % 1000 == 0:
print(f"Epoch {epoch}: Loss = {loss.item():.6f}")
return model
print("PINN architecture: input(x,t) -> 4x64 Tanh -> output(u)")
Neural ODE: Continuous-Time Dynamics
Neural ODEs model the rate of change of a hidden state with a neural network, enabling continuous-time sequence modeling.
pip install torchdiffeq
from torchdiffeq import odeint
class ODEFunc(nn.Module):
"""Defines the right-hand side f(t, y) = dy/dt"""
def __init__(self, dim: int = 2):
super().__init__()
self.net = nn.Sequential(
nn.Linear(dim, 64),
nn.Tanh(),
nn.Linear(64, 64),
nn.Tanh(),
nn.Linear(64, dim)
)
def forward(self, t: torch.Tensor, y: torch.Tensor) -> torch.Tensor:
return self.net(y)
class NeuralODE(nn.Module):
"""Neural ODE model"""
def __init__(self, dim: int = 2):
super().__init__()
self.odefunc = ODEFunc(dim)
def forward(self, y0: torch.Tensor, t_span: torch.Tensor) -> torch.Tensor:
"""
y0: initial state [batch, dim]
t_span: time points [T]
returns: states at each time point [T, batch, dim]
"""
return odeint(self.odefunc, y0, t_span, method='dopri5')
Example: Lotka-Volterra predator-prey model
def simulate_lotka_volterra():
model = NeuralODE(dim=2)
Initial conditions: 1000 rabbits, 100 foxes
y0 = torch.tensor([[1.0, 0.1]])
t = torch.linspace(0, 15, 300)
with torch.no_grad():
trajectory = model(y0, t)
print(f"Simulation shape: {trajectory.shape}") # [300, 1, 2]
return trajectory
Fourier Neural Operator (FNO)
FNO operates in the frequency domain to build resolution-independent PDE solvers.
class SpectralConv2d(nn.Module):
"""Core FNO block: convolution in the spectral domain"""
def __init__(self, in_channels: int, out_channels: int, modes: int = 12):
super().__init__()
self.modes = modes
scale = 1 / (in_channels * out_channels)
self.weights = nn.Parameter(
scale * torch.rand(in_channels, out_channels, modes, modes,
dtype=torch.cfloat)
)
def forward(self, x: torch.Tensor) -> torch.Tensor:
B, C, H, W = x.shape
x_ft = torch.fft.rfft2(x)
out_ft = torch.zeros(B, self.weights.shape[1], H, W // 2 + 1,
dtype=torch.cfloat, device=x.device)
Learn only low-frequency components
out_ft[:, :, :self.modes, :self.modes] = torch.einsum(
'bixy,ioxy->boxy',
x_ft[:, :, :self.modes, :self.modes],
self.weights
)
return torch.fft.irfft2(out_ft, s=(H, W))
6. AI Lab Automation: Self-Driving Laboratories
Bayesian Optimization for Experimental Design
A Self-Driving Lab (SDL) is a closed loop where AI designs experiments, robots execute them, and AI analyzes the results to propose the next experiment.
pip install scikit-optimize
from skopt import gp_minimize
from skopt.space import Real, Integer, Categorical
from skopt.utils import use_named_args
Define the experimental parameter space
Example: perovskite solar cell optimization
search_space = [
Real(0.5, 2.0, name="pb_concentration"), # Pb concentration (mol/L)
Real(0.3, 0.8, name="ma_ratio"), # MA:FA ratio
Real(50, 150, name="annealing_temp"), # Annealing temperature (C)
Integer(10, 60, name="annealing_time"), # Annealing time (minutes)
Categorical(["DMF", "DMSO", "GBL"], name="solvent")
]
@use_named_args(search_space)
def experimental_objective(
pb_concentration, ma_ratio, annealing_temp,
annealing_time, solvent
) -> float:
"""
Objective function for an experiment (in practice, calls a robotic system).
Returns: negative PCE (Power Conversion Efficiency) — minimization problem.
"""
noise = np.random.normal(0, 0.5)
pce = (
15.0
+ 2.0 * np.exp(-((pb_concentration - 1.2) ** 2) / 0.1)
+ 1.5 * np.exp(-((ma_ratio - 0.6) ** 2) / 0.05)
- 0.05 * abs(annealing_temp - 100)
+ noise
)
print(f"Experiment: Pb={pb_concentration:.2f}, MA={ma_ratio:.2f}, "
f"T={annealing_temp:.0f}C -> PCE={pce:.2f}%")
return -pce # minimize negative PCE
Run Bayesian optimization
result = gp_minimize(
func=experimental_objective,
dimensions=search_space,
n_calls=30, # total experiments
n_initial_points=10, # initial random exploration
acq_func="EI", # Expected Improvement acquisition function
random_state=42
)
print(f"\nBest PCE: {-result.fun:.2f}%")
print("Optimal parameters:")
for name, val in zip([s.name for s in search_space], result.x):
print(f" {name}: {val}")
7. Research Reproducibility: DVC and Experiment Tracking
Data Version Control with DVC
Initialize DVC alongside Git
git init
dvc init
Track large datasets (use DVC instead of Git-LFS)
dvc add data/protein_structures/
dvc add data/molecular_datasets/
Configure remote storage
dvc remote add -d myremote s3://mybucket/dvc-store
Define pipeline in dvc.yaml
stages:
preprocess:
cmd: python preprocess.py
deps: [data/raw/, src/preprocess.py]
outs: [data/processed/]
train:
cmd: python train.py --seed 42
deps: [data/processed/, src/train.py]
outs: [models/]
metrics: [metrics.json]
Reproduce the full pipeline
dvc repro
dvc push
Experiment Tracking with MLflow
def train_with_tracking(config: dict) -> float:
"""Track experiment parameters and metrics with MLflow"""
with mlflow.start_run():
Log hyperparameters
mlflow.log_params(config)
Fix seeds for reproducibility
torch.manual_seed(config["seed"])
np.random.seed(config["seed"])
Build model
model = MolecularGNN(
node_features=config["node_features"],
hidden_dim=config["hidden_dim"]
)
Training loop with metric logging
for epoch in range(config["epochs"]):
train_loss = np.random.exponential(1.0) / (epoch + 1)
val_auc = 1 - np.exp(-epoch / 20)
mlflow.log_metric("train_loss", train_loss, step=epoch)
mlflow.log_metric("val_auc", val_auc, step=epoch)
Save model artifact
mlflow.pytorch.log_model(model, "model")
mlflow.log_metric("final_val_auc", val_auc)
return val_auc
config = {
"seed": 42,
"node_features": 9,
"hidden_dim": 128,
"epochs": 100,
"lr": 1e-3,
"dataset": "tox21"
}
mlflow.set_experiment("molecular-property-prediction")
auc = train_with_tracking(config)
Reproducible Environments with Docker
Dockerfile
FROM pytorch/pytorch:2.2.0-cuda12.1-cudnn8-runtime
RUN apt-get update && apt-get install -y \
git wget curl \
&& rm -rf /var/lib/apt/lists/*
COPY requirements.txt .
RUN pip install --no-cache-dir -r requirements.txt
Environment variables for deterministic behavior
ENV PYTHONHASHSEED=42
ENV CUBLAS_WORKSPACE_CONFIG=:4096:8
WORKDIR /workspace
COPY . .
Quiz
**Answer**: To infer spatially proximate residue pairs from co-evolutionary patterns encoded in the MSA.
**Explanation**: Over millions of years of evolution, residue pairs that interact functionally tend to co-vary — when one mutates, the other often compensates. By analyzing correlated mutations across an MSA, one can predict which residue pairs are in contact in the 3D structure. AlphaFold2's Evoformer processes this co-evolutionary information as a pair representation and iteratively refines it alongside the MSA representation. ESMFold bypasses the need for an explicit MSA because its large protein language model (PLM) implicitly captures evolutionary information through pre-training on hundreds of millions of protein sequences.
**Answer**: By computing PDE residuals through automatic differentiation of the network output and adding them as a regularization term in the loss.
**Explanation**: The key idea is to treat the neural network output $u_\theta(x,t)$ as a candidate solution and penalize violations of the governing PDE. PyTorch's `autograd` computes exact partial derivatives $\partial u / \partial t$ and $\partial^2 u / \partial x^2$ through the network graph. The physics loss $\mathcal{L}_{physics} = ||\partial u / \partial t - \alpha \partial^2 u / \partial x^2||^2$ measures how well the network satisfies the PDE at a set of collocation points sampled inside the domain. Because physical laws constrain the solution everywhere — not just where data exists — PINNs often extrapolate more reliably than purely data-driven models.
**Answer**: Because a molecule's chemical properties are determined by its atom types and bonding topology — a natural graph structure.
**Explanation**: While SMILES strings linearize molecules into 1D sequences, their true structure is a graph. GNNs exploit this with message passing: each atom aggregates information from neighboring atoms, building up a representation of its local chemical environment. Stacking multiple layers allows the model to capture increasingly global structural context. Critically, this representation is permutation-invariant — the prediction is independent of how atoms are ordered — which matches the physical reality that a molecule has no canonical atom ordering. Chemprop's Directed Message Passing Neural Network (D-MPNN) further improves ring-system representations by passing messages along directed edges.
**Answer**: Bayesian optimization uses a Gaussian Process surrogate model and an acquisition function (e.g., Expected Improvement) to balance exploration and exploitation, avoiding the exponential scaling of grid search.
**Explanation**: Grid search scales exponentially with the number of parameters — the "curse of dimensionality." Bayesian optimization has two components: (1) a Gaussian Process that maintains a posterior distribution over the objective function conditioned on all previous evaluations, and (2) an acquisition function such as Expected Improvement (EI) that analytically identifies the point most likely to improve over the current best. EI naturally balances exploration (high uncertainty regions) and exploitation (promising regions near the current optimum). As each experiment is expensive (e.g., a synthesis run), converging to a near-optimal configuration in 30–50 experiments — rather than thousands — is a decisive practical advantage.
**Answer**: Neural ODEs model system dynamics directly as a continuous differential equation, rather than assuming fixed discrete time steps.
**Explanation**: Standard RNNs assume a fixed, uniform time step. This makes them ill-suited for irregularly sampled data or systems governed by continuous physical dynamics. A Neural ODE defines $dy/dt = f_\theta(t, y)$ and integrates it with an adaptive ODE solver (e.g., Dormand-Prince RK45), which can evaluate the state at any time point with adaptive step size. This yields three key advantages: (1) handling arbitrary time resolution without retraining, (2) representing continuous dynamics with fewer parameters than a deep RNN, and (3) computing gradients memory-efficiently via the adjoint method rather than storing intermediate activations. Neural ODEs are particularly well-suited for pharmacokinetics, climate variable trajectories, and any domain where an underlying continuous ODE governs the system.
Conclusion: The Future of AI for Science
AI is accelerating every phase of scientific research.
- **Protein structure**: AlphaFold3 now predicts complexes with DNA, RNA, and small molecules
- **Drug discovery**: Generative molecular AI compresses candidate identification from years to months
- **Climate science**: AI weather models like NeuralGCM and Pangu-Weather are beginning to match or exceed classical numerical forecasts
- **Physics simulation**: PINNs and FNO accelerate CFD and quantum simulations by orders of magnitude
- **Self-Driving Labs**: Closed-loop AI-robotic systems dramatically improve efficiency in materials discovery and chemical synthesis
The key insight underlying all of scientific AI is the **synergy between domain knowledge and data**. Embedding physical laws, chemical structure, or evolutionary information into AI models — rather than treating them as black boxes — consistently produces the most powerful and trustworthy results.
현재 단락 (1/436)
AI is no longer confined to generating text or classifying images. Today, AI solves protein folding ...