Skip to content

Split View: WebAssembly & 엣지 컴퓨팅: 브라우저 AI 추론, Cloudflare Workers, IoT Wasm까지

|

WebAssembly & 엣지 컴퓨팅: 브라우저 AI 추론, Cloudflare Workers, IoT Wasm까지

WebAssembly란 무엇인가?

WebAssembly(Wasm)는 2019년 W3C 공식 웹 표준으로 채택된 바이너리 명령어 포맷입니다. 브라우저, 서버, IoT 디바이스 어디서나 근-네이티브(near-native) 속도로 실행되며, JavaScript의 유일한 브라우저 실행 언어 지위를 사실상 종식시켰습니다.

Wasm의 핵심 설계 원칙은 다음 네 가지입니다.

  • 안전성(Safety): 샌드박스 메모리 모델로 호스트 환경을 보호합니다.
  • 이식성(Portability): CPU 아키텍처에 무관하게 동일하게 동작합니다.
  • 속도(Speed): JIT/AOT 컴파일로 JavaScript 대비 수 배 빠른 연산 처리를 달성합니다.
  • 개방성(Open): 특정 언어나 플랫폼에 종속되지 않습니다.

1. WAT 텍스트 포맷과 바이트코드 구조

WebAssembly는 .wasm 바이너리 포맷과 사람이 읽을 수 있는 .wat(WebAssembly Text Format) 두 가지 표현을 가집니다.

WAT 예시: 두 정수의 합

(module
  (func $add (param $a i32) (param $b i32) (result i32)
    local.get $a
    local.get $b
    i32.add)
  (export "add" (func $add)))

이 코드가 .wasm으로 컴파일되면 매직 넘버 \0asm(0x00 0x61 0x73 0x6D)으로 시작하는 바이너리가 됩니다.

바이트코드 구조

Wasm 모듈은 섹션(section) 단위로 구성됩니다.

섹션 ID이름설명
1Type함수 시그니처 정의
3Function함수 인덱스
7Export외부로 노출할 심볼
10Code실제 함수 바디

선형 메모리(Linear Memory)

Wasm은 단일 연속 바이트 배열인 선형 메모리를 사용합니다. 64KB 페이지 단위로 할당되며, JavaScript에서 WebAssembly.Memory 객체로 직접 접근할 수 있습니다.

const memory = new WebAssembly.Memory({ initial: 1, maximum: 10 })
const buffer = new Uint8Array(memory.buffer)
// 오프셋 0부터 직접 읽기/쓰기
buffer[0] = 42

포인터 연산 자체는 안전하게 샌드박스 내부에 격리되므로, 호스트 메모리에는 접근할 수 없습니다.


2. WASI: WebAssembly System Interface

WASI는 Wasm 모듈이 파일 시스템, 네트워크, 환경 변수 등 OS 기능에 접근하기 위한 표준 시스템 인터페이스입니다. "Write once, run anywhere"를 진정으로 실현하기 위해 Solomon Hykes(Docker 창시자)가 필요성을 공개적으로 역설하면서 주목받았습니다.

(import "wasi_snapshot_preview1" "fd_write"
  (func $fd_write (param i32 i32 i32 i32) (result i32)))

WASI가 제공하는 주요 추상화는 다음과 같습니다.

  • 파일 시스템: fd_read, fd_write, path_open
  • 시계: clock_time_get
  • 환경 변수: environ_get
  • 네트워크(WASI 0.2): wasi:sockets 인터페이스

WASI 0.2(Component Model)는 2024년 정식 출시되어 고수준 인터페이스 정의 언어인 WIT(Wasm Interface Types)를 도입했습니다.


3. Wasm 생태계: Rust, AssemblyScript, Emscripten

Rust → WebAssembly (wasm-pack)

Rust는 현재 Wasm 생태계에서 가장 성숙한 언어입니다. wasm-pack을 사용하면 npm 패키지로 즉시 배포 가능한 Wasm 모듈을 생성할 수 있습니다.

// src/lib.rs
use wasm_bindgen::prelude::*;

#[wasm_bindgen]
pub fn fibonacci(n: u32) -> u32 {
    match n {
        0 => 0,
        1 => 1,
        _ => fibonacci(n - 1) + fibonacci(n - 2),
    }
}

#[wasm_bindgen]
pub fn matrix_multiply(a: &[f32], b: &[f32], n: usize) -> Vec<f32> {
    let mut result = vec![0.0f32; n * n];
    for i in 0..n {
        for j in 0..n {
            for k in 0..n {
                result[i * n + j] += a[i * n + k] * b[k * n + j];
            }
        }
    }
    result
}

빌드 및 배포:

# wasm-pack 설치
cargo install wasm-pack

# 브라우저 타겟으로 빌드
wasm-pack build --target web

# Node.js 타겟으로 빌드
wasm-pack build --target nodejs

생성된 pkg/ 디렉토리에는 .wasm 바이너리, JavaScript 글루 코드, TypeScript 타입 정의가 포함됩니다.

JavaScript에서 Wasm 모듈 호출

import init, { fibonacci, matrix_multiply } from './pkg/my_module.js'

async function main() {
  // Wasm 모듈 초기화
  await init()

  // Fibonacci 계산
  console.log(fibonacci(40)) // 102334155

  // 행렬 곱셈 (4x4)
  const a = new Float32Array([1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16])
  const b = new Float32Array([1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1])
  const result = matrix_multiply(a, b, 4)
  console.log(result)
}

main()

AssemblyScript

TypeScript 문법으로 Wasm을 작성할 수 있는 언어입니다.

// assembly/index.ts
export function add(a: i32, b: i32): i32 {
  return a + b
}

export function sumArray(ptr: usize, len: i32): i64 {
  let sum: i64 = 0
  for (let i = 0; i < len; i++) {
    sum += load<i32>(ptr + i * 4)
  }
  return sum
}

Emscripten (C/C++)

C/C++ 코드베이스를 Wasm으로 포팅할 때 사용합니다. Figma와 Google Earth가 이 방식을 사용합니다.

# C 파일을 Wasm으로 컴파일
emcc compute.c -O3 -o compute.js \
  -s WASM=1 \
  -s EXPORTED_FUNCTIONS='["_process_image"]' \
  -s EXPORTED_RUNTIME_METHODS='["ccall","cwrap"]'

4. 브라우저 AI: ONNX Runtime Web, WebNN, WebGPU

ONNX Runtime Web으로 브라우저 AI 추론

ONNX Runtime Web은 브라우저에서 ONNX 모델을 직접 실행합니다. 백엔드로 WebAssembly(CPU), WebGL, WebGPU를 지원합니다.

import * as ort from 'onnxruntime-web'

async function runInference() {
  // WebGPU 백엔드 우선, 폴백으로 Wasm 사용
  const session = await ort.InferenceSession.create('/models/bert-base.onnx', {
    executionProviders: ['webgpu', 'wasm'],
    graphOptimizationLevel: 'all',
  })

  // 입력 텐서 생성
  const inputIds = new BigInt64Array([101n, 2023n, 2003n, 102n])
  const attentionMask = new BigInt64Array([1n, 1n, 1n, 1n])

  const feeds = {
    input_ids: new ort.Tensor('int64', inputIds, [1, 4]),
    attention_mask: new ort.Tensor('int64', attentionMask, [1, 4]),
  }

  const results = await session.run(feeds)
  console.log('Logits:', results.logits.data)
}

WebGPU Compute Shader로 행렬 연산

WebGPU는 GPU의 병렬 연산 능력을 웹에서 직접 활용할 수 있게 해줍니다. WebGL 대비 ML 추론에 훨씬 적합한 이유는 **컴퓨트 쉐이더(Compute Shader)**를 지원하기 때문입니다.

async function webgpuMatmul(matA, matB, M, N, K) {
  const adapter = await navigator.gpu.requestAdapter()
  const device = await adapter.requestDevice()

  const shaderCode = `
    @group(0) @binding(0) var<storage, read> matA: array<f32>;
    @group(0) @binding(1) var<storage, read> matB: array<f32>;
    @group(0) @binding(2) var<storage, read_write> result: array<f32>;

    @compute @workgroup_size(8, 8)
    fn main(@builtin(global_invocation_id) gid: vec3<u32>) {
      let row = gid.x;
      let col = gid.y;
      var sum = 0.0;
      for (var k = 0u; k < ${K}u; k++) {
        sum += matA[row * ${K}u + k] * matB[k * ${N}u + col];
      }
      result[row * ${N}u + col] = sum;
    }
  `

  const shaderModule = device.createShaderModule({ code: shaderCode })
  // ... 버퍼 생성, 파이프라인 설정, 디스패치
}

WebNN API

WebNN(Web Neural Network API)은 브라우저가 OS의 하드웨어 가속(NPU, GPU, DSP)을 직접 활용할 수 있도록 하는 W3C 표준 API입니다.

const context = await navigator.ml.createContext({ deviceType: 'gpu' })
const builder = new MLGraphBuilder(context)

const input = builder.input('input', { type: 'float32', dimensions: [1, 3, 224, 224] })
const weights = builder.constant(/* ... */)
const conv = builder.conv2d(input, weights, { padding: [1, 1, 1, 1] })
const relu = builder.relu(conv)

const graph = await builder.build({ output: relu })
const results = await context.compute(graph, inputs, outputs)

5. 엣지 AI 배포: Cloudflare Workers, Fastly, AWS Lambda@Edge

Cloudflare Workers AI

Cloudflare Workers는 V8 isolate 기반으로 전 세계 300개 이상의 PoP(Point of Presence)에서 실행됩니다. AI 바인딩을 통해 추론을 엣지에서 직접 수행합니다.

// Cloudflare Worker with AI binding
export default {
  async fetch(request, env) {
    const body = await request.json()
    const userMessage = body.message

    // AI 바인딩으로 LLM 추론
    const response = await env.AI.run('@cf/meta/llama-3.1-8b-instruct', {
      messages: [
        {
          role: 'system',
          content: 'You are a helpful assistant.',
        },
        {
          role: 'user',
          content: userMessage,
        },
      ],
      max_tokens: 512,
    })

    return new Response(JSON.stringify({ reply: response.response }), {
      headers: { 'Content-Type': 'application/json' },
    })
  },
}

wrangler.toml 설정:

name = "edge-ai-worker"
main = "src/index.js"
compatibility_date = "2024-09-23"

[ai]
binding = "AI"

Fastly Compute (Rust 기반 Wasm)

use fastly::{Error, Request, Response};

#[fastly::main]
fn main(req: Request) -> Result<Response, Error> {
    let body = req.into_body_str();

    // Wasm 내에서 직접 처리
    let processed = process_with_wasm(&body);

    Ok(Response::from_body(processed))
}

fn process_with_wasm(input: &str) -> String {
    // 엣지에서 실행되는 비즈니스 로직
    format!("Processed at edge: {}", input.to_uppercase())
}

AWS Lambda@Edge vs Cloudflare Workers 비교

특성Cloudflare WorkersAWS Lambda@Edge
실행 모델V8 Isolate컨테이너 기반
콜드 스타트~0ms100ms~수초
메모리 한도128MB128MB~10GB
실행 시간최대 30초(유료)최대 30초
전역 PoP300+CloudFront 엣지
언어 지원JS/TS, WasmNode.js, Python, Java 등

Cloudflare Workers가 콜드 스타트가 빠른 핵심 이유는 프로세스가 아닌 V8 isolate를 재사용하기 때문입니다. 각 Worker는 별도의 OS 프로세스 대신 동일 프로세스 내 격리된 JavaScript 실행 컨텍스트에서 동작합니다.


6. IoT & 임베디드 Wasm

WasmEdge

WasmEdge는 CNCF(Cloud Native Computing Foundation) 샌드박스 프로젝트로, IoT 및 엣지 디바이스용 경량 Wasm 런타임입니다.

# WasmEdge 설치
curl -sSf https://raw.githubusercontent.com/WasmEdge/WasmEdge/master/utils/install.sh | bash

# Python 스크립트를 Wasm으로 실행
wasmedge --dir .:. python_wasm.wasm script.py

WasmEdge로 Python 스크립트 실행:

# script.py - WasmEdge 위에서 동작
import sys
import json

def process_sensor_data(data):
    temperature = data.get('temperature', 0)
    humidity = data.get('humidity', 0)

    # 이상 감지 로직
    if temperature > 80 or humidity > 90:
        return {'alert': True, 'reason': 'threshold_exceeded'}
    return {'alert': False, 'status': 'normal'}

data = json.loads(sys.argv[1])
result = process_sensor_data(data)
print(json.dumps(result))

WAMR (WebAssembly Micro Runtime)

WAMR은 Bytecode Alliance가 개발한 초경량 Wasm 런타임으로 수 KB RAM에서도 동작합니다.

최소 메모리 요구사항:
- Interpreter 모드: ~85KB ROM + ~64KB RAM
- AOT 모드: ~60KB ROM + ~64KB RAM

Fermyon Spin

Spin은 Wasm 기반 마이크로서비스 프레임워크입니다.

# spin.toml
spin_manifest_version = 2

[application]
name = "iot-processor"
version = "0.1.0"

[[trigger.http]]
route = "/sensor"
component = "sensor-handler"

[component.sensor-handler]
source = "target/wasm32-wasi/release/sensor_handler.wasm"
[component.sensor-handler.build]
command = "cargo build --target wasm32-wasi --release"

7. 성능 벤치마킹: Wasm vs Native

SIMD in WebAssembly

Wasm SIMD(Single Instruction Multiple Data)는 128비트 벡터 연산을 지원하여 ML 워크로드를 크게 가속합니다.

// Rust에서 Wasm SIMD 활용
#[cfg(target_arch = "wasm32")]
use std::arch::wasm32::*;

pub fn dot_product_simd(a: &[f32], b: &[f32]) -> f32 {
    let mut sum = f32x4_splat(0.0);
    let chunks = a.len() / 4;

    for i in 0..chunks {
        let va = v128_load(a[i*4..].as_ptr() as *const v128);
        let vb = v128_load(b[i*4..].as_ptr() as *const v128);
        sum = f32x4_add(sum, f32x4_mul(va, vb));
    }

    // 수평 합산
    let arr: [f32; 4] = unsafe { std::mem::transmute(sum) };
    arr.iter().sum()
}

멀티스레딩: SharedArrayBuffer

Wasm 스레딩은 SharedArrayBufferAtomics API를 활용합니다.

// 공유 메모리로 Wasm 멀티스레딩
const sharedMemory = new WebAssembly.Memory({
  initial: 16,
  maximum: 256,
  shared: true, // SharedArrayBuffer 활성화
})

// Worker에 공유 메모리 전달
const worker = new Worker('wasm-worker.js')
worker.postMessage({ memory: sharedMemory })

벤치마크 결과 (참고치)

작업JavaScriptWasm (단일)Wasm + SIMDNative C
행렬 곱셈 (1024x1024)850ms210ms55ms40ms
SHA-256 해싱 (1MB)120ms35ms22ms18ms
이미지 리사이즈 (4K)340ms95ms28ms20ms

Wasm + SIMD는 네이티브 C와 10~40% 차이 이내로 수렴합니다.


8. 실전 사례

Figma

Figma의 렌더링 엔진 전체가 C++로 작성되어 Emscripten을 통해 Wasm으로 컴파일됩니다. 덕분에 복잡한 벡터 그래픽 연산을 브라우저에서 60fps로 처리합니다.

Google Earth

Google Earth for Web도 C++ 엔진을 Wasm으로 포팅했습니다. 수 GB에 달하는 3D 지형 렌더링 로직을 브라우저에서 실행합니다.

Pyodide: Python in Browser

Pyodide는 CPython 인터프리터 전체를 Wasm으로 컴파일하여 브라우저에서 Python을 실행합니다.

<script src="https://cdn.jsdelivr.net/pyodide/v0.27.0/full/pyodide.js"></script>
<script>
  async function runPython() {
    const pyodide = await loadPyodide()

    // numpy, pandas를 브라우저에서 설치 및 사용
    await pyodide.loadPackage(['numpy', 'pandas'])

    const result = pyodide.runPython(`
    import numpy as np
    import pandas as pd

    # 브라우저에서 numpy 연산
    arr = np.random.randn(1000, 1000)
    eigenvalues = np.linalg.eigvals(arr[:10, :10])
    float(np.abs(eigenvalues).max())
  `)

    console.log('최대 고유값:', result)
  }
  runPython()
</script>

퀴즈

Q1. WebAssembly가 JavaScript보다 숫자 연산에서 빠른 성능을 내는 근본적 이유는?

정답: 정적 타입 시스템과 AOT/JIT 컴파일의 예측 가능성

설명: JavaScript는 동적 타입 언어로 런타임에 타입 추론, 인라인 캐싱, 히든 클래스 변환 등 수많은 최적화를 거쳐야 합니다. 반면 Wasm은 컴파일 시점에 모든 타입이 확정되어 있어 JIT 엔진이 즉시 최적화된 기계어를 생성할 수 있습니다. 또한 Wasm 바이트코드는 파싱 오버헤드가 매우 낮고, SIMD/멀티스레딩 명령어를 명시적으로 사용할 수 있습니다.

Q2. WASI(WebAssembly System Interface)가 필요한 이유와 제공하는 추상화는?

정답: OS 종속성 없이 시스템 리소스에 접근하기 위한 표준 인터페이스

설명: 브라우저 밖에서 실행되는 Wasm 모듈은 파일 시스템, 네트워크, 환경 변수 등에 접근해야 하지만 Wasm 자체는 샌드박스로 격리되어 있습니다. WASI는 POSIX 유사 시스템 콜을 Wasm 인터페이스로 표준화하여, 동일한 .wasm 바이너리가 Linux, Windows, macOS, 임베디드 시스템 등 어디서나 동일하게 동작하도록 합니다. Docker 컨테이너 없이 Wasm 하나로 어디서나 실행 가능한 "컨테이너의 미래"로 불립니다.

Q3. WebGPU가 WebGL보다 ML 추론에 더 적합한 이유는?

정답: 컴퓨트 쉐이더 지원과 명시적 GPU 메모리 관리

설명: WebGL은 그래픽 렌더링 파이프라인에 특화되어 있어 범용 병렬 연산(GPGPU)이 제한적입니다. ML 추론의 핵심인 행렬 곱셈, 합성곱 등을 수행하려면 프래그먼트 쉐이더를 편법으로 활용해야 했습니다. WebGPU는 컴퓨트 쉐이더를 1급 기능으로 지원하고, 스토리지 버퍼를 통한 유연한 메모리 접근, 더 나은 비동기 실행 모델을 제공합니다. 실제로 ONNX Runtime Web의 WebGPU 백엔드는 WebGL 대비 2~5배 빠른 추론 속도를 보입니다.

Q4. Cloudflare Workers의 V8 isolate 기반 실행이 Lambda보다 콜드 스타트가 빠른 이유는?

정답: 프로세스/컨테이너 초기화 없이 V8 isolate 컨텍스트만 생성

설명: AWS Lambda는 요청마다 새 컨테이너(또는 실행 환경)를 프로비저닝하고, OS 부팅, 런타임 초기화 등을 거쳐야 합니다. 이 과정이 수백 ms에서 수초까지 걸립니다. Cloudflare Workers는 동일한 V8 프로세스 내에서 메모리 격리된 isolate를 순식간에 생성합니다. isolate 생성은 ~1ms 수준으로, 기존 프로세스의 JIT-컴파일된 코드를 재사용할 수 있어 실질적으로 콜드 스타트가 거의 0에 수렴합니다.

Q5. Pyodide가 Python을 브라우저에서 실행하기 위해 WebAssembly를 사용하는 방식은?

정답: CPython 인터프리터 전체를 Emscripten으로 Wasm으로 컴파일

설명: Pyodide는 CPython 3.x 소스 코드(C로 작성)를 Emscripten 툴체인으로 WebAssembly 바이너리로 컴파일합니다. 브라우저가 이 Wasm 바이너리를 로드하면 완전한 Python 인터프리터가 브라우저 탭 안에서 실행됩니다. numpy, scipy 등 C 확장 모듈도 동일하게 Wasm으로 컴파일되어 제공됩니다. JavaScript와의 양방향 바인딩(PyProxy, JsProxy)을 통해 Python 객체를 JS에서, JS 객체를 Python에서 직접 조작할 수 있습니다. JupyterLite와 같은 완전한 브라우저 기반 Jupyter 환경이 이 기술로 구현됩니다.


결론

WebAssembly는 단순한 "빠른 JavaScript 대체재"를 넘어 범용 런타임 플랫폼으로 진화하고 있습니다. WASI Component Model의 성숙, WebGPU의 확산, 엣지 플랫폼의 Wasm 채택 가속화로 인해 2026년 현재 Wasm은 다음과 같은 영역에서 표준 기술로 자리잡고 있습니다.

  • 브라우저 AI 추론 (ONNX Runtime Web + WebGPU)
  • 서버리스 엣지 함수 (Cloudflare Workers, Fastly)
  • IoT 및 임베디드 (WasmEdge, WAMR)
  • 플러그인 시스템 (Extism, waPC)

Rust로 시작하는 Wasm 개발, wasm-pack으로의 빌드, Cloudflare Workers 배포까지 이 가이드가 여러분의 엣지 컴퓨팅 여정의 나침반이 되길 바랍니다.

WebAssembly & Edge Computing: Browser AI Inference, Cloudflare Workers, and IoT Wasm

What Is WebAssembly?

WebAssembly (Wasm) is a binary instruction format that became a W3C official web standard in 2019. It runs at near-native speed in browsers, servers, and IoT devices alike, effectively ending JavaScript's monopoly as the only language that executes natively in browsers.

The four core design principles of Wasm are:

  • Safety: A sandboxed memory model protects the host environment.
  • Portability: Behaves identically regardless of CPU architecture.
  • Speed: JIT/AOT compilation achieves several times the throughput of JavaScript for compute-intensive workloads.
  • Openness: Not tied to any specific language or platform.

1. WAT Text Format and Bytecode Structure

WebAssembly has two representations: the .wasm binary format and the human-readable .wat (WebAssembly Text Format).

WAT Example: Sum of Two Integers

(module
  (func $add (param $a i32) (param $b i32) (result i32)
    local.get $a
    local.get $b
    i32.add)
  (export "add" (func $add)))

When compiled to .wasm, the binary starts with the magic number \0asm (0x00 0x61 0x73 0x6D).

Bytecode Structure

A Wasm module is organized into typed sections:

Section IDNameDescription
1TypeFunction signature definitions
3FunctionFunction index table
7ExportSymbols exposed to the host
10CodeActual function bodies

Linear Memory

Wasm uses a linear memory model — a single contiguous byte array. It is allocated in 64KB page units and can be accessed directly from JavaScript via the WebAssembly.Memory object.

const memory = new WebAssembly.Memory({ initial: 1, maximum: 10 })
const buffer = new Uint8Array(memory.buffer)
// Read/write directly starting at offset 0
buffer[0] = 42

Pointer arithmetic is safely sandboxed inside the Wasm instance; host memory is never accessible.


2. WASI: WebAssembly System Interface

WASI is a standard system interface that allows Wasm modules to access OS capabilities such as the file system, networking, and environment variables. Solomon Hykes (Docker's creator) famously said that if WASM+WASI had existed in 2008, Docker would not have been needed.

(import "wasi_snapshot_preview1" "fd_write"
  (func $fd_write (param i32 i32 i32 i32) (result i32)))

Key abstractions provided by WASI:

  • File system: fd_read, fd_write, path_open
  • Clocks: clock_time_get
  • Environment variables: environ_get
  • Networking (WASI 0.2): wasi:sockets interface

WASI 0.2 (Component Model), released in 2024, introduced WIT (Wasm Interface Types) — a high-level interface definition language for composable Wasm components.


3. The Wasm Ecosystem: Rust, AssemblyScript, Emscripten

Rust to WebAssembly with wasm-pack

Rust is currently the most mature language in the Wasm ecosystem. Using wasm-pack, you can produce npm-ready Wasm packages in minutes.

// src/lib.rs
use wasm_bindgen::prelude::*;

#[wasm_bindgen]
pub fn fibonacci(n: u32) -> u32 {
    match n {
        0 => 0,
        1 => 1,
        _ => fibonacci(n - 1) + fibonacci(n - 2),
    }
}

#[wasm_bindgen]
pub fn matrix_multiply(a: &[f32], b: &[f32], n: usize) -> Vec<f32> {
    let mut result = vec![0.0f32; n * n];
    for i in 0..n {
        for j in 0..n {
            for k in 0..n {
                result[i * n + j] += a[i * n + k] * b[k * n + j];
            }
        }
    }
    result
}

Build and deploy:

# Install wasm-pack
cargo install wasm-pack

# Build for browser target
wasm-pack build --target web

# Build for Node.js target
wasm-pack build --target nodejs

The generated pkg/ directory contains the .wasm binary, JavaScript glue code, and TypeScript type definitions.

Calling Wasm from JavaScript

import init, { fibonacci, matrix_multiply } from './pkg/my_module.js'

async function main() {
  // Initialize Wasm module
  await init()

  // Compute Fibonacci
  console.log(fibonacci(40)) // 102334155

  // Matrix multiplication (4x4)
  const a = new Float32Array([1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16])
  const b = new Float32Array([1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1])
  const result = matrix_multiply(a, b, 4)
  console.log(result)
}

main()

AssemblyScript

AssemblyScript lets you write Wasm using TypeScript-like syntax.

// assembly/index.ts
export function add(a: i32, b: i32): i32 {
  return a + b
}

export function sumArray(ptr: usize, len: i32): i64 {
  let sum: i64 = 0
  for (let i = 0; i < len; i++) {
    sum += load<i32>(ptr + i * 4)
  }
  return sum
}

Emscripten (C/C++)

Emscripten is the go-to toolchain for porting C/C++ codebases to Wasm. Figma and Google Earth both use this approach.

# Compile a C file to Wasm
emcc compute.c -O3 -o compute.js \
  -s WASM=1 \
  -s EXPORTED_FUNCTIONS='["_process_image"]' \
  -s EXPORTED_RUNTIME_METHODS='["ccall","cwrap"]'

4. Browser AI: ONNX Runtime Web, WebNN, WebGPU

In-Browser Inference with ONNX Runtime Web

ONNX Runtime Web runs ONNX models directly in the browser. It supports WebAssembly (CPU), WebGL, and WebGPU as execution backends.

import * as ort from 'onnxruntime-web'

async function runInference() {
  // Prefer WebGPU backend, fall back to Wasm
  const session = await ort.InferenceSession.create('/models/bert-base.onnx', {
    executionProviders: ['webgpu', 'wasm'],
    graphOptimizationLevel: 'all',
  })

  // Create input tensors
  const inputIds = new BigInt64Array([101n, 2023n, 2003n, 102n])
  const attentionMask = new BigInt64Array([1n, 1n, 1n, 1n])

  const feeds = {
    input_ids: new ort.Tensor('int64', inputIds, [1, 4]),
    attention_mask: new ort.Tensor('int64', attentionMask, [1, 4]),
  }

  const results = await session.run(feeds)
  console.log('Logits:', results.logits.data)
}

Matrix Multiplication with a WebGPU Compute Shader

WebGPU unlocks the GPU's parallel compute power directly from the web. The key reason it is far better than WebGL for ML inference is first-class compute shader support.

async function webgpuMatmul(matA, matB, M, N, K) {
  const adapter = await navigator.gpu.requestAdapter()
  const device = await adapter.requestDevice()

  const shaderCode = `
    @group(0) @binding(0) var<storage, read> matA: array<f32>;
    @group(0) @binding(1) var<storage, read> matB: array<f32>;
    @group(0) @binding(2) var<storage, read_write> result: array<f32>;

    @compute @workgroup_size(8, 8)
    fn main(@builtin(global_invocation_id) gid: vec3<u32>) {
      let row = gid.x;
      let col = gid.y;
      var sum = 0.0;
      for (var k = 0u; k < ${K}u; k++) {
        sum += matA[row * ${K}u + k] * matB[k * ${N}u + col];
      }
      result[row * ${N}u + col] = sum;
    }
  `

  const shaderModule = device.createShaderModule({ code: shaderCode })
  // ... create buffers, pipeline, dispatch
}

WebNN API

WebNN (Web Neural Network API) is a W3C standard that allows browsers to directly leverage OS-level hardware acceleration — NPUs, GPUs, and DSPs.

const context = await navigator.ml.createContext({ deviceType: 'gpu' })
const builder = new MLGraphBuilder(context)

const input = builder.input('input', { type: 'float32', dimensions: [1, 3, 224, 224] })
const weights = builder.constant(/* ... */)
const conv = builder.conv2d(input, weights, { padding: [1, 1, 1, 1] })
const relu = builder.relu(conv)

const graph = await builder.build({ output: relu })
const results = await context.compute(graph, inputs, outputs)

5. Edge AI Deployment: Cloudflare Workers, Fastly, AWS Lambda@Edge

Cloudflare Workers AI

Cloudflare Workers runs on a V8 isolate model across 300+ global PoPs (Points of Presence). With the AI binding, inference happens at the edge closest to your users.

// Cloudflare Worker with AI binding
export default {
  async fetch(request, env) {
    const body = await request.json()
    const userMessage = body.message

    // Run LLM inference via AI binding
    const response = await env.AI.run('@cf/meta/llama-3.1-8b-instruct', {
      messages: [
        {
          role: 'system',
          content: 'You are a helpful assistant.',
        },
        {
          role: 'user',
          content: userMessage,
        },
      ],
      max_tokens: 512,
    })

    return new Response(JSON.stringify({ reply: response.response }), {
      headers: { 'Content-Type': 'application/json' },
    })
  },
}

wrangler.toml configuration:

name = "edge-ai-worker"
main = "src/index.js"
compatibility_date = "2024-09-23"

[ai]
binding = "AI"

Fastly Compute (Rust-based Wasm)

use fastly::{Error, Request, Response};

#[fastly::main]
fn main(req: Request) -> Result<Response, Error> {
    let body = req.into_body_str();

    // Business logic processed entirely within Wasm
    let processed = process_at_edge(&body);

    Ok(Response::from_body(processed))
}

fn process_at_edge(input: &str) -> String {
    format!("Processed at edge: {}", input.to_uppercase())
}

Cloudflare Workers vs AWS Lambda@Edge Comparison

PropertyCloudflare WorkersAWS Lambda@Edge
Execution modelV8 IsolateContainer-based
Cold start~0ms100ms to seconds
Memory limit128MB128MB to 10GB
Max duration30s (paid plan)30s
Global PoPs300+CloudFront edges
Language supportJS/TS, WasmNode.js, Python, Java, etc.

The core reason Cloudflare Workers has near-zero cold starts is that it reuses V8 isolates rather than spawning new OS processes. Each Worker runs in an isolated JavaScript execution context within the same process, eliminating OS-level process initialization entirely.


6. IoT & Embedded Wasm

WasmEdge

WasmEdge is a CNCF sandbox project — a lightweight Wasm runtime optimized for IoT and edge devices.

# Install WasmEdge
curl -sSf https://raw.githubusercontent.com/WasmEdge/WasmEdge/master/utils/install.sh | bash

# Run a Python script via WasmEdge
wasmedge --dir .:. python_wasm.wasm script.py

Running a Python anomaly detection script on WasmEdge:

# script.py - runs on top of WasmEdge
import sys
import json

def process_sensor_data(data):
    temperature = data.get('temperature', 0)
    humidity = data.get('humidity', 0)

    if temperature > 80 or humidity > 90:
        return {'alert': True, 'reason': 'threshold_exceeded'}
    return {'alert': False, 'status': 'normal'}

data = json.loads(sys.argv[1])
result = process_sensor_data(data)
print(json.dumps(result))

WAMR (WebAssembly Micro Runtime)

WAMR, developed by the Bytecode Alliance, is an ultra-lightweight Wasm runtime that can operate with only a few kilobytes of RAM.

Minimum memory requirements:
- Interpreter mode: ~85KB ROM + ~64KB RAM
- AOT mode:         ~60KB ROM + ~64KB RAM

Fermyon Spin

Spin is a Wasm-based microservices framework that makes building and deploying edge functions straightforward.

# spin.toml
spin_manifest_version = 2

[application]
name = "iot-processor"
version = "0.1.0"

[[trigger.http]]
route = "/sensor"
component = "sensor-handler"

[component.sensor-handler]
source = "target/wasm32-wasi/release/sensor_handler.wasm"
[component.sensor-handler.build]
command = "cargo build --target wasm32-wasi --release"

7. Performance Benchmarking: Wasm vs Native

SIMD in WebAssembly

Wasm SIMD supports 128-bit vector operations, dramatically accelerating ML workloads.

// Using Wasm SIMD in Rust
#[cfg(target_arch = "wasm32")]
use std::arch::wasm32::*;

pub fn dot_product_simd(a: &[f32], b: &[f32]) -> f32 {
    let mut sum = f32x4_splat(0.0);
    let chunks = a.len() / 4;

    for i in 0..chunks {
        let va = v128_load(a[i*4..].as_ptr() as *const v128);
        let vb = v128_load(b[i*4..].as_ptr() as *const v128);
        sum = f32x4_add(sum, f32x4_mul(va, vb));
    }

    // Horizontal sum
    let arr: [f32; 4] = unsafe { std::mem::transmute(sum) };
    arr.iter().sum()
}

Multithreading with SharedArrayBuffer

Wasm threading leverages SharedArrayBuffer and the Atomics API.

// Wasm multithreading with shared memory
const sharedMemory = new WebAssembly.Memory({
  initial: 16,
  maximum: 256,
  shared: true, // Enables SharedArrayBuffer
})

// Pass shared memory to a Worker
const worker = new Worker('wasm-worker.js')
worker.postMessage({ memory: sharedMemory })

Benchmark Results (Reference)

TaskJavaScriptWasm (single)Wasm + SIMDNative C
Matrix multiply (1024x1024)850ms210ms55ms40ms
SHA-256 hash (1MB)120ms35ms22ms18ms
Image resize (4K)340ms95ms28ms20ms

Wasm + SIMD closes to within 10–40% of native C performance.


8. Real-World Case Studies

Figma

Figma's entire rendering engine is written in C++ and compiled to Wasm via Emscripten. This allows complex vector graphics operations to run at 60fps in the browser without any plugins.

Google Earth

Google Earth for Web ports its massive C++ 3D terrain rendering engine to the browser through Wasm, enabling gigabytes of 3D geographic data to be rendered client-side.

Pyodide: Python in the Browser

Pyodide compiles the entire CPython interpreter to Wasm, enabling full Python execution inside a browser tab.

<script src="https://cdn.jsdelivr.net/pyodide/v0.27.0/full/pyodide.js"></script>
<script>
  async function runPython() {
    const pyodide = await loadPyodide()

    // Install and use numpy/pandas entirely in the browser
    await pyodide.loadPackage(['numpy', 'pandas'])

    const result = pyodide.runPython(`
    import numpy as np
    import pandas as pd

    # numpy operations running in the browser
    arr = np.random.randn(1000, 1000)
    eigenvalues = np.linalg.eigvals(arr[:10, :10])
    float(np.abs(eigenvalues).max())
  `)

    console.log('Max eigenvalue:', result)
  }
  runPython()
</script>

Quiz

Q1. What is the fundamental reason WebAssembly outperforms JavaScript in numerical computation?

Answer: Static type system and predictable AOT/JIT compilation

Explanation: JavaScript is a dynamically typed language. At runtime, the JS engine must perform type inference, inline caching, hidden class transitions, and many other optimizations before generating machine code. Wasm, by contrast, has all types fixed at compile time, allowing the JIT engine to emit optimized machine code immediately. Additionally, Wasm bytecode has very low parsing overhead and gives explicit access to SIMD and multithreading instructions.

Q2. Why is WASI (WebAssembly System Interface) necessary, and what abstractions does it provide?

Answer: A standard interface for accessing system resources without OS-specific dependencies

Explanation: Wasm modules running outside the browser need access to file systems, networking, and environment variables, but Wasm itself is sandboxed with no system access. WASI standardizes POSIX-like system calls as Wasm interface imports, allowing the same .wasm binary to run identically on Linux, Windows, macOS, or embedded systems. It is often described as "the future of containers" — a single Wasm binary that runs anywhere without Docker.

Q3. Why is WebGPU more suitable than WebGL for ML inference?

Answer: First-class compute shader support and explicit GPU memory management

Explanation: WebGL is designed for graphics rendering pipelines, making general-purpose parallel computation (GPGPU) awkward — you had to abuse fragment shaders to perform matrix operations. WebGPU provides compute shaders as a first-class feature, flexible storage buffer access patterns, and a better asynchronous execution model. In practice, the ONNX Runtime Web WebGPU backend achieves 2–5x faster inference than the WebGL backend for transformer models.

Q4. Why do Cloudflare Workers have near-zero cold starts compared to AWS Lambda?

Answer: V8 isolates are created within an existing process, eliminating container/OS initialization

Explanation: AWS Lambda provisions a new container (or execution environment) for each cold start, which involves OS boot, runtime initialization, and code loading — adding hundreds of milliseconds to seconds of latency. Cloudflare Workers creates a memory-isolated V8 isolate inside an already-running V8 process in approximately 1ms. The existing process already has JIT-compiled code ready, so there is effectively no cold start delay in practice.

Q5. How does Pyodide use WebAssembly to run Python in the browser?

Answer: The entire CPython interpreter (written in C) is compiled to Wasm via the Emscripten toolchain

Explanation: Pyodide takes the CPython 3.x source code and compiles it to a WebAssembly binary using Emscripten. When a browser loads this Wasm binary, a complete Python interpreter runs inside the browser tab. C extension modules like numpy and scipy are similarly compiled to Wasm. Bidirectional Python-JavaScript bindings (PyProxy, JsProxy) allow Python objects to be manipulated from JS and JS objects from Python. Projects like JupyterLite build fully in-browser Jupyter environments on top of this foundation.


Conclusion

WebAssembly has evolved far beyond being a "faster JavaScript alternative" — it is becoming a universal runtime platform. With the maturation of the WASI Component Model, the growing adoption of WebGPU, and rapid uptake of Wasm across edge platforms, Wasm is now a standard technology in the following domains as of 2026:

  • Browser AI inference (ONNX Runtime Web + WebGPU)
  • Serverless edge functions (Cloudflare Workers, Fastly Compute)
  • IoT and embedded systems (WasmEdge, WAMR)
  • Plugin systems (Extism, waPC)

Whether you are starting with Rust and wasm-pack, deploying to Cloudflare Workers, or running ML models in the browser with WebGPU — this guide should serve as your compass into the world of edge computing with WebAssembly.